C26H39ClN6O4 — CID 158843890
1-(4-chlorophenyl)-3-[(2S)-1-[(2S)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 158843890) has the molecular formula C26H39ClN6O4 and a molecular weight of 535.09 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2S)-1-[(2S)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2S)-1-[(2S)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 158843890 |
| Molecular Formula | C26H39ClN6O4 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2S)-1-[(2S)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CCC(=O)[C@H](CCCN=C(N)N)CC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)Nc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C26H39ClN6O4/c1-4-21(34)17(7-5-13-30-25(28)29)15-22(35)20-8-6-14-33(20)24(36)23(16(2)3)32-26(37)31-19-11-9-18(27)10-12-19/h9-12,16-17,20,23H,4-8,13-15H2,1-3H3,(H4,28,29,30)(H2,31,32,37)/t17-,20+,23+/m1/s1 |
| InChIKey | WSUFLUHNXQCBRK-MONBJTKQSA-N |
| XLogP | 3.09 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|