C27H41ClN8O5 — CID 155555947
(2R)-1-[(2R)-2-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-chlorophenyl)propanoyl]pyrrolidine-2-carboxamide (PubChem CID 155555947) has the molecular formula C27H41ClN8O5 and a molecular weight of 593.13 g/mol. Its IUPAC name is (2R)-1-[(2R)-2-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-chlorophenyl)propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[(2R)-2-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-chlorophenyl)propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155555947 |
| Molecular Formula | C27H41ClN8O5 |
| Molecular Weight | 593.13 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | (2R)-1-[(2R)-2-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-chlorophenyl)propanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)N1CCC[C@@H]1C(N)=O)C(C)C |
| InChI | InChI=1S/C27H41ClN8O5/c1-15(2)22(33-16(3)37)25(40)34-19(6-4-12-32-27(30)31)24(39)35-20(14-17-8-10-18(28)11-9-17)26(41)36-13-5-7-21(36)23(29)38/h8-11,15,19-22H,4-7,12-14H2,1-3H3,(H2,29,38)(H,33,37)(H,34,40)(H,35,39)(H4,30,31,32)/t19-,20+,21+,22-/m0/s1 |
| InChIKey | UOIKAJRMKYVBJD-CBPXPLCBSA-N |
| XLogP | -0.46 |
| TPSA | 215.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.13 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|