C27H40ClN9O6 — CID 155554827
(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(2R)-1-[(2R)-2-carbamoylpyrrolidin-1-yl]-3-(4-chlorophenyl)-1-oxopropan-2-yl]pentanediamide (PubChem CID 155554827) has the molecular formula C27H40ClN9O6 and a molecular weight of 622.13 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(2R)-1-[(2R)-2-carbamoylpyrrolidin-1-yl]-3-(4-chlorophenyl)-1-oxopropan-2-yl]pentanediamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(2R)-1-[(2R)-2-carbamoylpyrrolidin-1-yl]-3-(4-chlorophenyl)-1-oxopropan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 155554827 |
| Molecular Formula | C27H40ClN9O6 |
| Molecular Weight | 622.13 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(2R)-1-[(2R)-2-carbamoylpyrrolidin-1-yl]-3-(4-chlorophenyl)-1-oxopropan-2-yl]pentanediamide |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)N1CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C27H40ClN9O6/c1-15(38)34-18(4-2-12-33-27(31)32)24(41)35-19(10-11-22(29)39)25(42)36-20(14-16-6-8-17(28)9-7-16)26(43)37-13-3-5-21(37)23(30)40/h6-9,18-21H,2-5,10-14H2,1H3,(H2,29,39)(H2,30,40)(H,34,38)(H,35,41)(H,36,42)(H4,31,32,33)/t18-,19-,20+,21+/m0/s1 |
| InChIKey | AQFSRNQRSXLKSH-UWHLTILDSA-N |
| XLogP | -1.85 |
| TPSA | 258.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.13 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|