C31H41N5O5 — CID 157080299
benzyl N-[(2S)-1-[(2S)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 157080299) has the molecular formula C31H41N5O5 and a molecular weight of 563.70 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2S)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2S)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 157080299 |
| Molecular Formula | C31H41N5O5 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | benzyl N-[(2S)-1-[(2S)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCC(=O)C(CCCN=C(N)N)CC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H41N5O5/c1-2-27(37)24(15-9-17-34-30(32)33)20-28(38)26-16-10-18-36(26)29(39)25(19-22-11-5-3-6-12-22)35-31(40)41-21-23-13-7-4-8-14-23/h3-8,11-14,24-26H,2,9-10,15-21H2,1H3,(H,35,40)(H4,32,33,34)/t24?,25-,26-/m0/s1 |
| InChIKey | RRYRHROWBBASLY-WIXBZOCESA-N |
| XLogP | 3.12 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|