C32H40FN3O5 — CID 159483874
benzyl (3R)-4-[(2S)-2-[(3R)-6-(1-aminoethenylamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidin-1-yl]-3-benzyl-4-oxobutanoate (PubChem CID 159483874) has the molecular formula C32H40FN3O5 and a molecular weight of 565.69 g/mol. Its IUPAC name is benzyl (3R)-4-[(2S)-2-[(3R)-6-(1-aminoethenylamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidin-1-yl]-3-benzyl-4-oxobutanoate.
| Compound Name | benzyl (3R)-4-[(2S)-2-[(3R)-6-(1-aminoethenylamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidin-1-yl]-3-benzyl-4-oxobutanoate |
|---|---|
| PubChem CID | 159483874 |
| Molecular Formula | C32H40FN3O5 |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | benzyl (3R)-4-[(2S)-2-[(3R)-6-(1-aminoethenylamino)-3-(2-fluoroacetyl)hexanoyl]pyrrolidin-1-yl]-3-benzyl-4-oxobutanoate |
| SMILES | C=C(N)NCCCC(CC(=O)[C@@H]1CCCN1C(=O)[C@@H](CC(=O)OCc1ccccc1)Cc1ccccc1)C(=O)CF |
| InChI | InChI=1S/C32H40FN3O5/c1-23(34)35-16-8-14-26(30(38)21-33)19-29(37)28-15-9-17-36(28)32(40)27(18-24-10-4-2-5-11-24)20-31(39)41-22-25-12-6-3-7-13-25/h2-7,10-13,26-28,35H,1,8-9,14-22,34H2/t26?,27-,28+/m1/s1 |
| InChIKey | PZJMTPBTABBNPF-OEBVTXOESA-N |
| XLogP | 3.88 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|