C33H45N3O7 — CID 22852827
tert-butyl (2S)-1-[5-(phenylmethoxycarbonylamino)-2-[3-(phenylmethoxycarbonylamino)propyl]pentanoyl]pyrrolidine-2-carboxylate (PubChem CID 22852827) has the molecular formula C33H45N3O7 and a molecular weight of 595.74 g/mol. Its IUPAC name is tert-butyl (2S)-1-[5-(phenylmethoxycarbonylamino)-2-[3-(phenylmethoxycarbonylamino)propyl]pentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[5-(phenylmethoxycarbonylamino)-2-[3-(phenylmethoxycarbonylamino)propyl]pentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22852827 |
| Molecular Formula | C33H45N3O7 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | tert-butyl (2S)-1-[5-(phenylmethoxycarbonylamino)-2-[3-(phenylmethoxycarbonylamino)propyl]pentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)C(CCCNC(=O)OCc1ccccc1)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H45N3O7/c1-33(2,3)43-30(38)28-19-12-22-36(28)29(37)27(17-10-20-34-31(39)41-23-25-13-6-4-7-14-25)18-11-21-35-32(40)42-24-26-15-8-5-9-16-26/h4-9,13-16,27-28H,10-12,17-24H2,1-3H3,(H,34,39)(H,35,40)/t28-/m0/s1 |
| InChIKey | BCQXQVYGLLCQLD-NDEPHWFRSA-N |
| XLogP | 5.35 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|