C22H30N2O7 — CID 138597495
tert-butyl (2S)-1-[3-acetyloxy-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 138597495) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is tert-butyl (2S)-1-[3-acetyloxy-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[3-acetyloxy-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 138597495 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | tert-butyl (2S)-1-[3-acetyloxy-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=O)OCC(NC(=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O7/c1-15(25)29-14-17(23-21(28)30-13-16-9-6-5-7-10-16)19(26)24-12-8-11-18(24)20(27)31-22(2,3)4/h5-7,9-10,17-18H,8,11-14H2,1-4H3,(H,23,28)/t17?,18-/m0/s1 |
| InChIKey | AOTFHIZKROGNEZ-ZVAWYAOSSA-N |
| XLogP | 2.18 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|