C29H52N8O6 — CID 172951782
2-amino-3-methyl-N-[1-[2-[2-[3-methyl-6-[[(Z)-N'-nitrocarbamimidoyl]amino]hexanoyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-1-oxoheptan-2-yl]butanamide (PubChem CID 172951782) has the molecular formula C29H52N8O6 and a molecular weight of 608.79 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[1-[2-[2-[3-methyl-6-[[(Z)-N'-nitrocarbamimidoyl]amino]hexanoyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-1-oxoheptan-2-yl]butanamide.
| Compound Name | 2-amino-3-methyl-N-[1-[2-[2-[3-methyl-6-[[(Z)-N'-nitrocarbamimidoyl]amino]hexanoyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-1-oxoheptan-2-yl]butanamide |
|---|---|
| PubChem CID | 172951782 |
| Molecular Formula | C29H52N8O6 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.40 |
| IUPAC Name | 2-amino-3-methyl-N-[1-[2-[2-[3-methyl-6-[[(Z)-N'-nitrocarbamimidoyl]amino]hexanoyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-1-oxoheptan-2-yl]butanamide |
| SMILES | CCCCCC(NC(=O)C(N)C(C)C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)CC(C)CCCN/C(N)=N\[N+](=O)[O-] |
| InChI | InChI=1S/C29H52N8O6/c1-5-6-7-12-21(33-26(39)25(30)19(2)3)27(40)36-17-10-14-23(36)28(41)35-16-9-13-22(35)24(38)18-20(4)11-8-15-32-29(31)34-37(42)43/h19-23,25H,5-18,30H2,1-4H3,(H,33,39)(H3,31,32,34) |
| InChIKey | YENUFGJPWLCTIC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 206.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|