C22H31N7O8 — CID 131710598
(2S)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[3-(phenylmethoxycarbonylamino)propanoylamino]pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 131710598) has the molecular formula C22H31N7O8 and a molecular weight of 521.53 g/mol. Its IUPAC name is (2S)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[3-(phenylmethoxycarbonylamino)propanoylamino]pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[3-(phenylmethoxycarbonylamino)propanoylamino]pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 131710598 |
| Molecular Formula | C22H31N7O8 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (2S)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[3-(phenylmethoxycarbonylamino)propanoylamino]pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | N/C(=N\CCC[C@H](NC(=O)CCNC(=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O)N[N+](=O)[O-] |
| InChI | InChI=1S/C22H31N7O8/c23-21(27-29(35)36)24-11-4-8-16(19(31)28-13-5-9-17(28)20(32)33)26-18(30)10-12-25-22(34)37-14-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2,(H,25,34)(H,26,30)(H,32,33)(H3,23,24,27)/t16-,17-/m0/s1 |
| InChIKey | DHPPCJDJDNXPIE-IRXDYDNUSA-N |
| XLogP | -0.26 |
| TPSA | 218.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|