C28H38N6O7S — CID 15513890
benzyl N-[(2S)-5-[[amino-[(4-methoxyphenyl)sulfonylamino]methylidene]amino]-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]carbamate (PubChem CID 15513890) has the molecular formula C28H38N6O7S and a molecular weight of 602.71 g/mol. Its IUPAC name is benzyl N-[(2S)-5-[[amino-[(4-methoxyphenyl)sulfonylamino]methylidene]amino]-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-[[amino-[(4-methoxyphenyl)sulfonylamino]methylidene]amino]-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 15513890 |
| Molecular Formula | C28H38N6O7S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | benzyl N-[(2S)-5-[[amino-[(4-methoxyphenyl)sulfonylamino]methylidene]amino]-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]carbamate |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC/N=C(\N)NS(=O)(=O)c1ccc(OC)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H38N6O7S/c1-3-30-25(35)24-12-8-18-34(24)26(36)23(32-28(37)41-19-20-9-5-4-6-10-20)11-7-17-31-27(29)33-42(38,39)22-15-13-21(40-2)14-16-22/h4-6,9-10,13-16,23-24H,3,7-8,11-12,17-19H2,1-2H3,(H,30,35)(H,32,37)(H3,29,31,33)/t23-,24-/m0/s1 |
| InChIKey | HMMVTHRCKCNKQS-ZEQRLZLVSA-N |
| XLogP | 1.49 |
| TPSA | 181.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|