C24H31N7O9 — CID 131717414
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(2S)-1-[(2S)-5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid (PubChem CID 131717414) has the molecular formula C24H31N7O9 and a molecular weight of 561.55 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(2S)-1-[(2S)-5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(2S)-1-[(2S)-5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 131717414 |
| Molecular Formula | C24H31N7O9 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(2S)-1-[(2S)-5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
| SMILES | N/C(=N\CCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCC(=O)N1C(=O)OCc1ccccc1)C(=O)O)N[N+](=O)[O-] |
| InChI | InChI=1S/C24H31N7O9/c25-23(28-31(38)39)26-12-4-8-16(22(35)36)27-20(33)17-9-5-13-29(17)21(34)18-10-11-19(32)30(18)24(37)40-14-15-6-2-1-3-7-15/h1-3,6-7,16-18H,4-5,8-14H2,(H,27,33)(H,35,36)(H3,25,26,28)/t16-,17-,18-/m0/s1 |
| InChIKey | URYDEFGNHBYCJY-BZSNNMDCSA-N |
| XLogP | -0.25 |
| TPSA | 226.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|