C32H50N6O7 — CID 15308579
benzyl (2R)-2-[(2S)-2-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 15308579) has the molecular formula C32H50N6O7 and a molecular weight of 630.79 g/mol. Its IUPAC name is benzyl (2R)-2-[(2S)-2-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[(2S)-2-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15308579 |
| Molecular Formula | C32H50N6O7 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | benzyl (2R)-2-[(2S)-2-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CCCCOC(OCCCC)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H]1CCC(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H50N6O7/c1-3-5-20-43-30(44-21-6-4-2)24(14-10-18-35-31(33)34)36-28(40)25-15-11-19-37(25)29(41)26-16-17-27(39)38(26)32(42)45-22-23-12-8-7-9-13-23/h7-9,12-13,24-26,30H,3-6,10-11,14-22H2,1-2H3,(H,36,40)(H4,33,34,35)/t24-,25-,26+/m0/s1 |
| InChIKey | CUWOSMQYOUVMSN-KKUQBAQOSA-N |
| XLogP | 2.80 |
| TPSA | 178.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|