C23H41N5O3 — CID 22860222
(2S)-2-amino-N-[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]-3-phenylpropanamide (PubChem CID 22860222) has the molecular formula C23H41N5O3 and a molecular weight of 435.61 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 22860222 |
| Molecular Formula | C23H41N5O3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]-3-phenylpropanamide |
| SMILES | CCCCOC(OCCCC)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C23H41N5O3/c1-3-5-15-30-22(31-16-6-4-2)20(13-10-14-27-23(25)26)28-21(29)19(24)17-18-11-8-7-9-12-18/h7-9,11-12,19-20,22H,3-6,10,13-17,24H2,1-2H3,(H,28,29)(H4,25,26,27)/t19-,20-/m0/s1 |
| InChIKey | KSDQFTSQOOOKOI-PMACEKPBSA-N |
| XLogP | 2.05 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|