C33H49N9O6 — CID 162529580
ethyl N-[(5S)-6-amino-5-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 162529580) has the molecular formula C33H49N9O6 and a molecular weight of 667.81 g/mol. Its IUPAC name is ethyl N-[(5S)-6-amino-5-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | ethyl N-[(5S)-6-amino-5-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 162529580 |
| Molecular Formula | C33H49N9O6 |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.38 |
| IUPAC Name | ethyl N-[(5S)-6-amino-5-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | CCOC(=O)NCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C33H49N9O6/c1-2-48-33(47)39-18-10-9-16-25(28(35)43)40-31(46)27(21-23-14-7-4-8-15-23)42-30(45)26(17-11-19-38-32(36)37)41-29(44)24(34)20-22-12-5-3-6-13-22/h3-8,12-15,24-27H,2,9-11,16-21,34H2,1H3,(H2,35,43)(H,39,47)(H,40,46)(H,41,44)(H,42,45)(H4,36,37,38)/t24-,25-,26+,27-/m0/s1 |
| InChIKey | SKSXOXGSVWELAB-NFGXINMFSA-N |
| XLogP | -0.29 |
| TPSA | 259.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|