C34H50N8O7 — CID 151841402
benzyl N-[(5S)-6-amino-5-[[(2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 151841402) has the molecular formula C34H50N8O7 and a molecular weight of 682.82 g/mol. Its IUPAC name is benzyl N-[(5S)-6-amino-5-[[(2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-6-amino-5-[[(2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 151841402 |
| Molecular Formula | C34H50N8O7 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.38 |
| IUPAC Name | benzyl N-[(5S)-6-amino-5-[[(2S)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C34H50N8O7/c1-34(2,3)49-33(47)42-26(18-12-20-38-31(36)37)29(44)41-27(21-23-13-6-4-7-14-23)30(45)40-25(28(35)43)17-10-11-19-39-32(46)48-22-24-15-8-5-9-16-24/h4-9,13-16,25-27H,10-12,17-22H2,1-3H3,(H2,35,43)(H,39,46)(H,40,45)(H,41,44)(H,42,47)(H4,36,37,38)/t25-,26+,27-/m0/s1 |
| InChIKey | SGSRLSRAWZWMDA-VJGNERBWSA-N |
| XLogP | 1.73 |
| TPSA | 242.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|