C21H44N6O4 — CID 88599369
(2R)-2-amino-N-[2-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]amino]-2-oxoethyl]-3-methylbutanamide (PubChem CID 88599369) has the molecular formula C21H44N6O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]amino]-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2R)-2-amino-N-[2-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]amino]-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 88599369 |
| Molecular Formula | C21H44N6O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | (2R)-2-amino-N-[2-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]amino]-2-oxoethyl]-3-methylbutanamide |
| SMILES | CCCCOC(OCCCC)[C@H](CCCN=C(N)N)NC(=O)CNC(=O)[C@H](N)C(C)C |
| InChI | InChI=1S/C21H44N6O4/c1-5-7-12-30-20(31-13-8-6-2)16(10-9-11-25-21(23)24)27-17(28)14-26-19(29)18(22)15(3)4/h15-16,18,20H,5-14,22H2,1-4H3,(H,26,29)(H,27,28)(H4,23,24,25)/t16-,18+/m0/s1 |
| InChIKey | KPOAEWVBBAFHBI-FUHWJXTLSA-N |
| XLogP | 0.58 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|