C20H40N8O5 — CID 18294426
2-[[6-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18294426) has the molecular formula C20H40N8O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18294426 |
| Molecular Formula | C20H40N8O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NCC(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H40N8O5/c1-3-12(2)16(22)18(31)26-11-15(29)27-13(7-4-5-9-21)17(30)28-14(19(32)33)8-6-10-25-20(23)24/h12-14,16H,3-11,21-22H2,1-2H3,(H,26,31)(H,27,29)(H,28,30)(H,32,33)(H4,23,24,25) |
| InChIKey | MHQMXZOAILOCJU-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|