C13H28N6O2 — CID 177369506
5-(diaminomethylideneamino)-2-(ethylamino)-N-[2-oxo-2-(propan-2-ylamino)ethyl]pentanamide (PubChem CID 177369506) has the molecular formula C13H28N6O2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(ethylamino)-N-[2-oxo-2-(propan-2-ylamino)ethyl]pentanamide.
| Compound Name | 5-(diaminomethylideneamino)-2-(ethylamino)-N-[2-oxo-2-(propan-2-ylamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 177369506 |
| Molecular Formula | C13H28N6O2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(ethylamino)-N-[2-oxo-2-(propan-2-ylamino)ethyl]pentanamide |
| SMILES | CCNC(CCCN=C(N)N)C(=O)NCC(=O)NC(C)C |
| InChI | InChI=1S/C13H28N6O2/c1-4-16-10(6-5-7-17-13(14)15)12(21)18-8-11(20)19-9(2)3/h9-10,16H,4-8H2,1-3H3,(H,18,21)(H,19,20)(H4,14,15,17) |
| InChIKey | XWNHFDZWRNBSOG-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|