C30H49ClN6O7 — CID 22860224
benzyl (2R)-2-[[(2S)-1-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]-5-oxopyrrolidine-1-carboxylate;hydrochloride (PubChem CID 22860224) has the molecular formula C30H49ClN6O7 and a molecular weight of 641.21 g/mol. Its IUPAC name is benzyl (2R)-2-[[(2S)-1-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]-5-oxopyrrolidine-1-carboxylate;hydrochloride.
| Compound Name | benzyl (2R)-2-[[(2S)-1-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]-5-oxopyrrolidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 22860224 |
| Molecular Formula | C30H49ClN6O7 |
| Molecular Weight | 641.21 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | benzyl (2R)-2-[[(2S)-1-[[(2S)-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]-5-oxopyrrolidine-1-carboxylate;hydrochloride |
| SMILES | CCCCOC(OCCCC)[C@H](CCCN=C(N)N)NC(=O)[C@H](C)NC(=O)[C@H]1CCC(=O)N1C(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C30H48N6O7.ClH/c1-4-6-18-41-28(42-19-7-5-2)23(14-11-17-33-29(31)32)35-26(38)21(3)34-27(39)24-15-16-25(37)36(24)30(40)43-20-22-12-9-8-10-13-22;/h8-10,12-13,21,23-24,28H,4-7,11,14-20H2,1-3H3,(H,34,39)(H,35,38)(H4,31,32,33);1H/t21-,23-,24+;/m0./s1 |
| InChIKey | DJZXAKLNYBPDLW-HQROKSDRSA-N |
| XLogP | 2.74 |
| TPSA | 187.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|