C29H39N7O9 — CID 117065895
methyl 5-[[amino(nitramido)methylidene]amino]-2-[2,6-bis(phenylmethoxycarbonylamino)hexanoylamino]pentanoate (PubChem CID 117065895) has the molecular formula C29H39N7O9 and a molecular weight of 629.67 g/mol. Its IUPAC name is methyl 5-[[amino(nitramido)methylidene]amino]-2-[2,6-bis(phenylmethoxycarbonylamino)hexanoylamino]pentanoate.
| Compound Name | methyl 5-[[amino(nitramido)methylidene]amino]-2-[2,6-bis(phenylmethoxycarbonylamino)hexanoylamino]pentanoate |
|---|---|
| PubChem CID | 117065895 |
| Molecular Formula | C29H39N7O9 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | methyl 5-[[amino(nitramido)methylidene]amino]-2-[2,6-bis(phenylmethoxycarbonylamino)hexanoylamino]pentanoate |
| SMILES | COC(=O)C(CCC/N=C(\N)N[N+](=O)[O-])NC(=O)C(CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H39N7O9/c1-43-26(38)24(16-10-18-31-27(30)35-36(41)42)33-25(37)23(34-29(40)45-20-22-13-6-3-7-14-22)15-8-9-17-32-28(39)44-19-21-11-4-2-5-12-21/h2-7,11-14,23-24H,8-10,15-20H2,1H3,(H,32,39)(H,33,37)(H,34,40)(H3,30,31,35) |
| InChIKey | AXFFJYHLEIHFCU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 225.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|