C21H32N6O7 — CID 10696087
methyl (2S)-2-[[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoate (PubChem CID 10696087) has the molecular formula C21H32N6O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10696087 |
| Molecular Formula | C21H32N6O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | methyl (2S)-2-[[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](CCC/N=C(\N)N[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N6O7/c1-21(2,3)34-20(30)25-15(11-8-12-23-19(22)26-27(31)32)17(28)24-16(18(29)33-4)13-14-9-6-5-7-10-14/h5-7,9-10,15-16H,8,11-13H2,1-4H3,(H,24,28)(H,25,30)(H3,22,23,26)/t15-,16+/m1/s1 |
| InChIKey | HBIIQKBUNDXIST-CVEARBPZSA-N |
| XLogP | 0.66 |
| TPSA | 187.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|