C21H33N5O6 — CID 11178468
(2R,5S)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid (PubChem CID 11178468) has the molecular formula C21H33N5O6 and a molecular weight of 451.52 g/mol. Its IUPAC name is (2R,5S)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid.
| Compound Name | (2R,5S)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 11178468 |
| Molecular Formula | C21H33N5O6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (2R,5S)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(CCC/N=C(\N)N[N+](=O)[O-])C(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C21H33N5O6/c1-21(2,3)32-20(29)24-17(14-15-8-5-4-6-9-15)12-11-16(18(27)28)10-7-13-23-19(22)25-26(30)31/h4-6,8-9,16-17H,7,10-14H2,1-3H3,(H,24,29)(H,27,28)(H3,22,23,25)/t16?,17-/m0/s1 |
| InChIKey | HQJCLVPQGATOOS-DJNXLDHESA-N |
| XLogP | 2.48 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|