C18H28N6O5 — CID 10811418
tert-butyl N-[5-[[amino(nitramido)methylidene]amino]-1-(benzylamino)-1-oxopentan-2-yl]carbamate (PubChem CID 10811418) has the molecular formula C18H28N6O5 and a molecular weight of 408.46 g/mol. Its IUPAC name is tert-butyl N-[5-[[amino(nitramido)methylidene]amino]-1-(benzylamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[[amino(nitramido)methylidene]amino]-1-(benzylamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10811418 |
| Molecular Formula | C18H28N6O5 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | tert-butyl N-[5-[[amino(nitramido)methylidene]amino]-1-(benzylamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCC/N=C(\N)N[N+](=O)[O-])C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H28N6O5/c1-18(2,3)29-17(26)22-14(10-7-11-20-16(19)23-24(27)28)15(25)21-12-13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-12H2,1-3H3,(H,21,25)(H,22,26)(H3,19,20,23) |
| InChIKey | ODINYNFXCMWREP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|