C24H36N8O4 — CID 44596328
tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 44596328) has the molecular formula C24H36N8O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 44596328 |
| Molecular Formula | C24H36N8O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H36N8O4/c1-24(2,3)36-23(35)32-19(12-17-14-27-15-30-17)21(34)31-18(10-7-11-28-22(25)26)20(33)29-13-16-8-5-4-6-9-16/h4-6,8-9,14-15,18-19H,7,10-13H2,1-3H3,(H,27,30)(H,29,33)(H,31,34)(H,32,35)(H4,25,26,28)/t18-,19-/m0/s1 |
| InChIKey | JMXZBJCIZHMZRJ-OALUTQOASA-N |
| XLogP | 0.70 |
| TPSA | 189.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|