C30H46N8O4 — CID 44597947
tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(2-cyclohexyl-1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 44597947) has the molecular formula C30H46N8O4 and a molecular weight of 582.75 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(2-cyclohexyl-1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(2-cyclohexyl-1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 44597947 |
| Molecular Formula | C30H46N8O4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(2-cyclohexyl-1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cnc(C2CCCCC2)[nH]1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H46N8O4/c1-30(2,3)42-29(41)38-24(17-22-19-34-25(36-22)21-13-8-5-9-14-21)27(40)37-23(15-10-16-33-28(31)32)26(39)35-18-20-11-6-4-7-12-20/h4,6-7,11-12,19,21,23-24H,5,8-10,13-18H2,1-3H3,(H,34,36)(H,35,39)(H,37,40)(H,38,41)(H4,31,32,33)/t23-,24-/m0/s1 |
| InChIKey | QMSJLLJTHQWFNS-ZEQRLZLVSA-N |
| XLogP | 2.75 |
| TPSA | 189.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|