C17H29N7O3 — CID 44596657
methyl (2S)-2-[[(2S)-2-amino-3-(2-cyclobutyl-1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate (PubChem CID 44596657) has the molecular formula C17H29N7O3 and a molecular weight of 379.47 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-3-(2-cyclobutyl-1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-3-(2-cyclobutyl-1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 44596657 |
| Molecular Formula | C17H29N7O3 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-3-(2-cyclobutyl-1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1cnc(C2CCC2)[nH]1 |
| InChI | InChI=1S/C17H29N7O3/c1-27-16(26)13(6-3-7-21-17(19)20)24-15(25)12(18)8-11-9-22-14(23-11)10-4-2-5-10/h9-10,12-13H,2-8,18H2,1H3,(H,22,23)(H,24,25)(H4,19,20,21)/t12-,13-/m0/s1 |
| InChIKey | SXRXWNUZQOVGKL-STQMWFEESA-N |
| XLogP | -0.74 |
| TPSA | 174.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|