C19H33N9O5 — CID 18500232
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 18500232) has the molecular formula C19H33N9O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18500232 |
| Molecular Formula | C19H33N9O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | CC(C)C(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C19H33N9O5/c1-10(2)15(28-16(31)12(20)6-11-7-23-9-26-11)18(33)27-13(4-3-5-24-19(21)22)17(32)25-8-14(29)30/h7,9-10,12-13,15H,3-6,8,20H2,1-2H3,(H,23,26)(H,25,32)(H,27,33)(H,28,31)(H,29,30)(H4,21,22,24) |
| InChIKey | UCKOXLYKDRHDPC-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|