C22H39N9O5S — CID 18493421
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18493421) has the molecular formula C22H39N9O5S and a molecular weight of 541.68 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18493421 |
| Molecular Formula | C22H39N9O5S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1cnc[nH]1)C(C)C)C(=O)O |
| InChI | InChI=1S/C22H39N9O5S/c1-12(2)17(20(34)30-16(21(35)36)6-8-37-3)31-19(33)15(5-4-7-27-22(24)25)29-18(32)14(23)9-13-10-26-11-28-13/h10-12,14-17H,4-9,23H2,1-3H3,(H,26,28)(H,29,32)(H,30,34)(H,31,33)(H,35,36)(H4,24,25,27) |
| InChIKey | OLRSGWMIGWDMIF-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|