C22H38N10O6S — CID 18497444
5-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 18497444) has the molecular formula C22H38N10O6S and a molecular weight of 570.68 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18497444 |
| Molecular Formula | C22H38N10O6S |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CSCCC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H38N10O6S/c1-39-8-6-15(30-18(34)13(23)9-12-10-27-11-29-12)20(36)31-14(3-2-7-28-22(25)26)19(35)32-16(21(37)38)4-5-17(24)33/h10-11,13-16H,2-9,23H2,1H3,(H2,24,33)(H,27,29)(H,30,34)(H,31,36)(H,32,35)(H,37,38)(H4,25,26,28) |
| InChIKey | MISSUWPRTDTXFJ-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 286.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|