C19H33N9O5S — CID 18495458
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18495458) has the molecular formula C19H33N9O5S and a molecular weight of 499.60 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18495458 |
| Molecular Formula | C19H33N9O5S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCN=C(N)N)NC(=O)CNC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C19H33N9O5S/c1-34-6-4-14(18(32)33)28-17(31)13(3-2-5-24-19(21)22)27-15(29)9-25-16(30)12(20)7-11-8-23-10-26-11/h8,10,12-14H,2-7,9,20H2,1H3,(H,23,26)(H,25,30)(H,27,29)(H,28,31)(H,32,33)(H4,21,22,24) |
| InChIKey | PJVLCRSHAFEDAL-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|