C23H37N11O5S — CID 18497446
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18497446) has the molecular formula C23H37N11O5S and a molecular weight of 579.69 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18497446 |
| Molecular Formula | C23H37N11O5S |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CSCCC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C23H37N11O5S/c1-40-6-4-17(32-19(35)15(24)7-13-9-27-11-30-13)21(37)33-16(3-2-5-29-23(25)26)20(36)34-18(22(38)39)8-14-10-28-12-31-14/h9-12,15-18H,2-8,24H2,1H3,(H,27,30)(H,28,31)(H,32,35)(H,33,37)(H,34,36)(H,38,39)(H4,25,26,29) |
| InChIKey | LEQDDWKQTWBGAA-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 272.38 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|