C26H39N9O6S — CID 18497456
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18497456) has the molecular formula C26H39N9O6S and a molecular weight of 605.72 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18497456 |
| Molecular Formula | C26H39N9O6S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CSCCC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C26H39N9O6S/c1-42-10-8-20(33-22(37)18(27)12-16-13-30-14-32-16)24(39)34-19(3-2-9-31-26(28)29)23(38)35-21(25(40)41)11-15-4-6-17(36)7-5-15/h4-7,13-14,18-21,36H,2-3,8-12,27H2,1H3,(H,30,32)(H,33,37)(H,34,39)(H,35,38)(H,40,41)(H4,28,29,31) |
| InChIKey | LJEINOSGGPHEJU-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|