C20H36N12O5 — CID 18493056
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 18493056) has the molecular formula C20H36N12O5 and a molecular weight of 524.59 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18493056 |
| Molecular Formula | C20H36N12O5 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H36N12O5/c21-12(7-11-8-26-10-30-11)16(35)31-14(4-2-6-28-20(24)25)18(37)32-13(3-1-5-27-19(22)23)17(36)29-9-15(33)34/h8,10,12-14H,1-7,9,21H2,(H,26,30)(H,29,36)(H,31,35)(H,32,37)(H,33,34)(H4,22,23,27)(H4,24,25,28) |
| InChIKey | KBNZHBWVWSVIPR-UHFFFAOYSA-N |
| XLogP | -4.44 |
| TPSA | 308.10 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|