C18H29N9O7 — CID 18493856
3-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-[[1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18493856) has the molecular formula C18H29N9O7 and a molecular weight of 483.49 g/mol. Its IUPAC name is 3-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-[[1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-[[1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18493856 |
| Molecular Formula | C18H29N9O7 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-[[1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CC(=O)O)NC(=O)C(N)Cc1cnc[nH]1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C18H29N9O7/c19-10(4-9-6-22-8-25-9)15(32)27-12(5-13(28)29)17(34)26-11(2-1-3-23-18(20)21)16(33)24-7-14(30)31/h6,8,10-12H,1-5,7,19H2,(H,22,25)(H,24,33)(H,26,34)(H,27,32)(H,28,29)(H,30,31)(H4,20,21,23) |
| InChIKey | LCSOTBLVAVKDTI-UHFFFAOYSA-N |
| XLogP | -4.02 |
| TPSA | 281.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|