C20H35N9O5 — CID 18492669
2-[[2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid (PubChem CID 18492669) has the molecular formula C20H35N9O5 and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-[[2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18492669 |
| Molecular Formula | C20H35N9O5 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 2-[[2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C20H35N9O5/c1-10(2)15(19(33)34)29-18(32)14(5-4-6-25-20(22)23)28-16(30)11(3)27-17(31)13(21)7-12-8-24-9-26-12/h8-11,13-15H,4-7,21H2,1-3H3,(H,24,26)(H,27,31)(H,28,30)(H,29,32)(H,33,34)(H4,22,23,25) |
| InChIKey | PGIZHWQCBNOZPU-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|