C21H36N10O6 — CID 22652655
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid (PubChem CID 22652655) has the molecular formula C21H36N10O6 and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22652655 |
| Molecular Formula | C21H36N10O6 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H36N10O6/c1-10(2)16(20(36)37)31-19(35)14(6-11-8-26-9-28-11)30-18(34)13(4-3-5-27-21(24)25)29-17(33)12(22)7-15(23)32/h8-10,12-14,16H,3-7,22H2,1-2H3,(H2,23,32)(H,26,28)(H,29,33)(H,30,34)(H,31,35)(H,36,37)(H4,24,25,27) |
| InChIKey | KFAWUSWWILOYLS-UHFFFAOYSA-N |
| XLogP | -3.60 |
| TPSA | 286.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|