C21H37N9O6 — CID 18244031
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylbutanoic acid (PubChem CID 18244031) has the molecular formula C21H37N9O6 and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18244031 |
| Molecular Formula | C21H37N9O6 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCCN=C(N)N)C(C)O)C(=O)O |
| InChI | InChI=1S/C21H37N9O6/c1-10(2)15(20(35)36)29-19(34)16(11(3)31)30-18(33)14(7-12-8-25-9-27-12)28-17(32)13(22)5-4-6-26-21(23)24/h8-11,13-16,31H,4-7,22H2,1-3H3,(H,25,27)(H,28,32)(H,29,34)(H,30,33)(H,35,36)(H4,23,24,26) |
| InChIKey | STNHNCMEQMJGSN-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|