C20H34N10O7 — CID 18244014
4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoic acid (PubChem CID 18244014) has the molecular formula C20H34N10O7 and a molecular weight of 526.56 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18244014 |
| Molecular Formula | C20H34N10O7 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H34N10O7/c1-9(31)15(18(35)29-13(19(36)37)6-14(22)32)30-17(34)12(5-10-7-25-8-27-10)28-16(33)11(21)3-2-4-26-20(23)24/h7-9,11-13,15,31H,2-6,21H2,1H3,(H2,22,32)(H,25,27)(H,28,33)(H,29,35)(H,30,34)(H,36,37)(H4,23,24,26) |
| InChIKey | WQSLROMWMNOPFR-UHFFFAOYSA-N |
| XLogP | -4.87 |
| TPSA | 307.02 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|