C20H33N9O8 — CID 18253050
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18253050) has the molecular formula C20H33N9O8 and a molecular weight of 527.54 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18253050 |
| Molecular Formula | C20H33N9O8 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H33N9O8/c1-9(30)15(29-16(33)11(21)6-14(31)32)18(35)28-13(5-10-7-24-8-26-10)17(34)27-12(19(36)37)3-2-4-25-20(22)23/h7-9,11-13,15,30H,2-6,21H2,1H3,(H,24,26)(H,27,34)(H,28,35)(H,29,33)(H,31,32)(H,36,37)(H4,22,23,25) |
| InChIKey | SKECPXWVNIIYDX-UHFFFAOYSA-N |
| XLogP | -4.27 |
| TPSA | 301.23 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|