C19H33N9O6 — CID 18240696
2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18240696) has the molecular formula C19H33N9O6 and a molecular weight of 483.53 g/mol. Its IUPAC name is 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18240696 |
| Molecular Formula | C19H33N9O6 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C19H33N9O6/c1-9(26-16(31)12(20)4-3-5-24-19(21)22)15(30)27-13(6-11-7-23-8-25-11)17(32)28-14(10(2)29)18(33)34/h7-10,12-14,29H,3-6,20H2,1-2H3,(H,23,25)(H,26,31)(H,27,30)(H,28,32)(H,33,34)(H4,21,22,24) |
| InChIKey | IRKINEPVTNVSSS-UHFFFAOYSA-N |
| XLogP | -3.73 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|