C22H40N10O6 — CID 18305507
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18305507) has the molecular formula C22H40N10O6 and a molecular weight of 540.63 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18305507 |
| Molecular Formula | C22H40N10O6 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C22H40N10O6/c1-12(33)17(21(37)38)32-19(35)15(6-4-8-28-22(25)26)30-20(36)16(9-13-10-27-11-29-13)31-18(34)14(24)5-2-3-7-23/h10-12,14-17,33H,2-9,23-24H2,1H3,(H,27,29)(H,30,36)(H,31,34)(H,32,35)(H,37,38)(H4,25,26,28) |
| InChIKey | HWFDBEHJUKEPCI-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 289.95 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|