C17H30N8O4 — CID 145453844
(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid (PubChem CID 145453844) has the molecular formula C17H30N8O4 and a molecular weight of 410.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 145453844 |
| Molecular Formula | C17H30N8O4 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H30N8O4/c1-9(2)13(16(28)29)25-15(27)12(6-10-7-21-8-23-10)24-14(26)11(18)4-3-5-22-17(19)20/h7-9,11-13H,3-6,18H2,1-2H3,(H,21,23)(H,24,26)(H,25,27)(H,28,29)(H4,19,20,22)/t11-,12-,13-/m0/s1 |
| InChIKey | DGFXIWKPTDKBLF-AVGNSLFASA-N |
| XLogP | -1.96 |
| TPSA | 214.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|