C22H37N9O7 — CID 22651848
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid (PubChem CID 22651848) has the molecular formula C22H37N9O7 and a molecular weight of 539.59 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22651848 |
| Molecular Formula | C22H37N9O7 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H37N9O7/c1-11(2)17(31-18(34)13(23)4-3-7-27-22(24)25)20(36)30-15(8-12-9-26-10-28-12)19(35)29-14(21(37)38)5-6-16(32)33/h9-11,13-15,17H,3-8,23H2,1-2H3,(H,26,28)(H,29,35)(H,30,36)(H,31,34)(H,32,33)(H,37,38)(H4,24,25,27) |
| InChIKey | CYUZNZMXFYEFMG-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 281.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|