C21H33N9O9 — CID 18242575
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[3-carboxy-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18242575) has the molecular formula C21H33N9O9 and a molecular weight of 555.55 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[3-carboxy-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[3-carboxy-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242575 |
| Molecular Formula | C21H33N9O9 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[3-carboxy-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C21H33N9O9/c22-11(2-1-5-26-21(23)24)17(35)28-12(3-4-15(31)32)18(36)29-13(7-16(33)34)19(37)30-14(20(38)39)6-10-8-25-9-27-10/h8-9,11-14H,1-7,22H2,(H,25,27)(H,28,35)(H,29,36)(H,30,37)(H,31,32)(H,33,34)(H,38,39)(H4,23,24,26) |
| InChIKey | XOBVJWZWOVYPHE-UHFFFAOYSA-N |
| XLogP | -3.79 |
| TPSA | 318.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|