C21H34N10O8 — CID 18243068
2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid (PubChem CID 18243068) has the molecular formula C21H34N10O8 and a molecular weight of 554.57 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18243068 |
| Molecular Formula | C21H34N10O8 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H34N10O8/c22-11(2-1-5-27-21(24)25)17(35)29-12(3-4-15(23)32)18(36)30-13(6-10-8-26-9-28-10)19(37)31-14(20(38)39)7-16(33)34/h8-9,11-14H,1-7,22H2,(H2,23,32)(H,26,28)(H,29,35)(H,30,36)(H,31,37)(H,33,34)(H,38,39)(H4,24,25,27) |
| InChIKey | YFPAEKDXWXUYSC-UHFFFAOYSA-N |
| XLogP | -4.39 |
| TPSA | 324.09 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|