C20H32N10O8 — CID 18243736
2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid (PubChem CID 18243736) has the molecular formula C20H32N10O8 and a molecular weight of 540.54 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18243736 |
| Molecular Formula | C20H32N10O8 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H32N10O8/c21-10(2-1-3-26-20(23)24)16(34)28-11(4-9-7-25-8-27-9)17(35)29-12(5-14(22)31)18(36)30-13(19(37)38)6-15(32)33/h7-8,10-13H,1-6,21H2,(H2,22,31)(H,25,27)(H,28,34)(H,29,35)(H,30,36)(H,32,33)(H,37,38)(H4,23,24,26) |
| InChIKey | ZBSXGTAZYMEPDV-UHFFFAOYSA-N |
| XLogP | -4.78 |
| TPSA | 324.09 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | -4.78 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|