C22H36N10O8 — CID 22701134
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid (PubChem CID 22701134) has the molecular formula C22H36N10O8 and a molecular weight of 568.59 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22701134 |
| Molecular Formula | C22H36N10O8 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H36N10O8/c23-12(3-5-16(24)33)18(36)30-13(2-1-7-28-22(25)26)19(37)32-15(8-11-9-27-10-29-11)20(38)31-14(21(39)40)4-6-17(34)35/h9-10,12-15H,1-8,23H2,(H2,24,33)(H,27,29)(H,30,36)(H,31,38)(H,32,37)(H,34,35)(H,39,40)(H4,25,26,28) |
| InChIKey | QNYGZPBOQYEHBI-UHFFFAOYSA-N |
| XLogP | -4.00 |
| TPSA | 324.09 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|