C23H39N9O7 — CID 18244656
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid (PubChem CID 18244656) has the molecular formula C23H39N9O7 and a molecular weight of 553.62 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18244656 |
| Molecular Formula | C23H39N9O7 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H39N9O7/c1-12(2)8-16(31-19(35)14(24)4-3-7-28-23(25)26)20(36)32-17(9-13-10-27-11-29-13)21(37)30-15(22(38)39)5-6-18(33)34/h10-12,14-17H,3-9,24H2,1-2H3,(H,27,29)(H,30,37)(H,31,35)(H,32,36)(H,33,34)(H,38,39)(H4,25,26,28) |
| InChIKey | HWFTVMWZHBBYNP-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 281.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|