C27H41N9O5 — CID 18244664
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18244664) has the molecular formula C27H41N9O5 and a molecular weight of 571.68 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18244664 |
| Molecular Formula | C27H41N9O5 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H41N9O5/c1-16(2)11-20(34-23(37)19(28)9-6-10-32-27(29)30)24(38)35-21(13-18-14-31-15-33-18)25(39)36-22(26(40)41)12-17-7-4-3-5-8-17/h3-5,7-8,14-16,19-22H,6,9-13,28H2,1-2H3,(H,31,33)(H,34,37)(H,35,38)(H,36,39)(H,40,41)(H4,29,30,32) |
| InChIKey | ZNPDXBLQZPLPMX-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|