C30H39N9O5 — CID 18245850
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18245850) has the molecular formula C30H39N9O5 and a molecular weight of 605.70 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18245850 |
| Molecular Formula | C30H39N9O5 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H39N9O5/c31-22(12-7-13-35-30(32)33)26(40)37-23(14-19-8-3-1-4-9-19)27(41)38-24(16-21-17-34-18-36-21)28(42)39-25(29(43)44)15-20-10-5-2-6-11-20/h1-6,8-11,17-18,22-25H,7,12-16,31H2,(H,34,36)(H,37,40)(H,38,41)(H,39,42)(H,43,44)(H4,32,33,35) |
| InChIKey | JNFBBBMLLDBONR-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|